C14H28O — CID 142091721
2-(7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)ethanol;ethane (PubChem CID 142091721) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is 2-(7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)ethanol;ethane.
| Compound Name | 2-(7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)ethanol;ethane |
|---|---|
| PubChem CID | 142091721 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 2-(7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)ethanol;ethane |
| SMILES | CC.CC12CCCCC1CCC2CCO |
| InChI | InChI=1S/C12H22O.C2H6/c1-12-8-3-2-4-10(12)5-6-11(12)7-9-13;1-2/h10-11,13H,2-9H2,1H3;1-2H3 |
| InChIKey | MJPSNXKKDSBVIL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |