C9H17ClO — CID 11240783
2-[(1R,2S)-2-chloro-2-methylcyclohexyl]ethanol (PubChem CID 11240783) has the molecular formula C9H17ClO and a molecular weight of 176.69 g/mol. Its IUPAC name is 2-[(1R,2S)-2-chloro-2-methylcyclohexyl]ethanol.
| Compound Name | 2-[(1R,2S)-2-chloro-2-methylcyclohexyl]ethanol |
|---|---|
| PubChem CID | 11240783 |
| Molecular Formula | C9H17ClO |
| Molecular Weight | 176.69 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-[(1R,2S)-2-chloro-2-methylcyclohexyl]ethanol |
| SMILES | C[C@]1(Cl)CCCC[C@@H]1CCO |
| InChI | InChI=1S/C9H17ClO/c1-9(10)6-3-2-4-8(9)5-7-11/h8,11H,2-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | RCTFCKBLTMCSOR-BDAKNGLRSA-N |
| XLogP | 2.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.69 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|