C27H49NO — CID 143658974
4-[4-[(10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butylamino]butan-1-ol (PubChem CID 143658974) has the molecular formula C27H49NO and a molecular weight of 403.70 g/mol. Its IUPAC name is 4-[4-[(10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butylamino]butan-1-ol.
| Compound Name | 4-[4-[(10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butylamino]butan-1-ol |
|---|---|
| PubChem CID | 143658974 |
| Molecular Formula | C27H49NO |
| Molecular Weight | 403.70 g/mol |
| Exact Mass | 403.38 |
| IUPAC Name | 4-[4-[(10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butylamino]butan-1-ol |
| SMILES | C[C@]12CCCCC1CCC1C2CC[C@]2(C)C(CCCCNCCCCO)CCC12 |
| InChI | InChI=1S/C27H49NO/c1-26-16-5-3-9-21(26)11-13-23-24-14-12-22(27(24,2)17-15-25(23)26)10-4-6-18-28-19-7-8-20-29/h21-25,28-29H,3-20H2,1-2H3/t21?,22?,23?,24?,25?,26-,27+/m0/s1 |
| InChIKey | QJDSNJNZAFFSNG-LWEUULQHSA-N |
| XLogP | 6.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.70 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|