C25H42O2 — CID 145266290
6-[(10S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoic acid (PubChem CID 145266290) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is 6-[(10S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoic acid.
| Compound Name | 6-[(10S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoic acid |
|---|---|
| PubChem CID | 145266290 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | 6-[(10S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoic acid |
| SMILES | CC12CCC3C(CCC4CCCC[C@@]43C)C1CCC2CCCCCC(=O)O |
| InChI | InChI=1S/C25H42O2/c1-24-16-7-6-9-18(24)11-13-20-21-14-12-19(8-4-3-5-10-23(26)27)25(21,2)17-15-22(20)24/h18-22H,3-17H2,1-2H3,(H,26,27)/t18?,19?,20?,21?,22?,24-,25?/m0/s1 |
| InChIKey | URRIJTCFNXZOAL-IRWJGMOJSA-N |
| XLogP | 7.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|