C30H56O2 — CID 145259156
4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoic acid;ethane;2-methylbutane (PubChem CID 145259156) has the molecular formula C30H56O2 and a molecular weight of 448.78 g/mol. Its IUPAC name is 4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoic acid;ethane;2-methylbutane.
| Compound Name | 4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoic acid;ethane;2-methylbutane |
|---|---|
| PubChem CID | 145259156 |
| Molecular Formula | C30H56O2 |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 448.43 |
| IUPAC Name | 4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoic acid;ethane;2-methylbutane |
| SMILES | CC.CC12CCCCC1CCC1C2CCC2(C)C(CCCC(=O)O)CCC12.CCC(C)C |
| InChI | InChI=1S/C23H38O2.C5H12.C2H6/c1-22-14-4-3-6-16(22)9-11-18-19-12-10-17(7-5-8-21(24)25)23(19,2)15-13-20(18)22;1-4-5(2)3;1-2/h16-20H,3-15H2,1-2H3,(H,24,25);5H,4H2,1-3H3;1-2H3 |
| InChIKey | DNXDRXVORHCRNP-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |