C28H47NO — CID 142305150
acetylene;4-[(10S,13R,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-propan-2-ylbutanamide (PubChem CID 142305150) has the molecular formula C28H47NO and a molecular weight of 413.69 g/mol. Its IUPAC name is acetylene;4-[(10S,13R,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-propan-2-ylbutanamide.
| Compound Name | acetylene;4-[(10S,13R,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 142305150 |
| Molecular Formula | C28H47NO |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 413.37 |
| IUPAC Name | acetylene;4-[(10S,13R,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-propan-2-ylbutanamide |
| SMILES | C#C.CC(C)NC(=O)CCC[C@H]1CCC2C3CCC4CCCC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C26H45NO.C2H2/c1-18(2)27-24(28)10-7-9-20-12-14-22-21-13-11-19-8-5-6-16-25(19,3)23(21)15-17-26(20,22)4;1-2/h18-23H,5-17H2,1-4H3,(H,27,28);1-2H/t19?,20-,21?,22?,23?,25-,26+;/m0./s1 |
| InChIKey | YEEKENZQKBCICF-YGSZGGJRSA-N |
| XLogP | 6.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|