C24H38O4 — CID 142566750
2-[2-[(13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]propanedioic acid (PubChem CID 142566750) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is 2-[2-[(13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]propanedioic acid.
| Compound Name | 2-[2-[(13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]propanedioic acid |
|---|---|
| PubChem CID | 142566750 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 2-[2-[(13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]propanedioic acid |
| SMILES | CC12CCCCC1CCC1C2CC[C@@]2(C)C1CC[C@@H]2CCC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H38O4/c1-23-13-4-3-5-15(23)6-9-17-19-11-8-16(24(19,2)14-12-20(17)23)7-10-18(21(25)26)22(27)28/h15-20H,3-14H2,1-2H3,(H,25,26)(H,27,28)/t15?,16-,17?,19?,20?,23?,24+/m0/s1 |
| InChIKey | LXNHIFVBVYYKCY-BSRCNIJSSA-N |
| XLogP | 5.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|