C33H56O4 — CID 145266278
ditert-butyl 2-[3-[(10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]propanedioate (PubChem CID 145266278) has the molecular formula C33H56O4 and a molecular weight of 516.81 g/mol. Its IUPAC name is ditert-butyl 2-[3-[(10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]propanedioate.
| Compound Name | ditert-butyl 2-[3-[(10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]propanedioate |
|---|---|
| PubChem CID | 145266278 |
| Molecular Formula | C33H56O4 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 516.42 |
| IUPAC Name | ditert-butyl 2-[3-[(10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(CCCC1CCC2C3CCC4CCCC[C@]4(C)C3CC[C@]12C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H56O4/c1-30(2,3)36-28(34)25(29(35)37-31(4,5)6)14-11-13-23-16-18-26-24-17-15-22-12-9-10-20-32(22,7)27(24)19-21-33(23,26)8/h22-27H,9-21H2,1-8H3/t22?,23?,24?,26?,27?,32-,33+/m0/s1 |
| InChIKey | FIGATGIIPMUDBU-XGGZKZRPSA-N |
| XLogP | 8.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|