C29H52N2O — CID 145177919
3-[4-[(8S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]-1-ethyl-1-propylurea (PubChem CID 145177919) has the molecular formula C29H52N2O and a molecular weight of 444.75 g/mol. Its IUPAC name is 3-[4-[(8S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]-1-ethyl-1-propylurea.
| Compound Name | 3-[4-[(8S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]-1-ethyl-1-propylurea |
|---|---|
| PubChem CID | 145177919 |
| Molecular Formula | C29H52N2O |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 444.41 |
| IUPAC Name | 3-[4-[(8S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]-1-ethyl-1-propylurea |
| SMILES | CCCN(CC)C(=O)NCCCCC1CCC2[C@@H]3CCC4CCCCC4(C)C3CC[C@]12C |
| InChI | InChI=1S/C29H52N2O/c1-5-21-31(6-2)27(32)30-20-10-8-12-23-14-16-25-24-15-13-22-11-7-9-18-28(22,3)26(24)17-19-29(23,25)4/h22-26H,5-21H2,1-4H3,(H,30,32)/t22?,23?,24-,25?,26?,28?,29+/m0/s1 |
| InChIKey | BJIPSXXHIUOTOU-IQHAMGJRSA-N |
| XLogP | 7.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|