C31H47FN2OS — CID 145089950
1-[3-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-(3-fluorophenyl)sulfanylurea (PubChem CID 145089950) has the molecular formula C31H47FN2OS and a molecular weight of 514.80 g/mol. Its IUPAC name is 1-[3-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-(3-fluorophenyl)sulfanylurea.
| Compound Name | 1-[3-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-(3-fluorophenyl)sulfanylurea |
|---|---|
| PubChem CID | 145089950 |
| Molecular Formula | C31H47FN2OS |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.34 |
| IUPAC Name | 1-[3-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-(3-fluorophenyl)sulfanylurea |
| SMILES | CC[C@H]1CC2C3CCC(CCCNC(=O)NSc4cccc(F)c4)C3(C)CC[C@@H]2C2(C)CCCCC12 |
| InChI | InChI=1S/C31H47FN2OS/c1-4-21-19-25-27-14-13-22(9-8-18-33-29(35)34-36-24-11-7-10-23(32)20-24)30(27,2)17-15-28(25)31(3)16-6-5-12-26(21)31/h7,10-11,20-22,25-28H,4-6,8-9,12-19H2,1-3H3,(H2,33,34,35)/t21-,22?,25?,26?,27?,28-,30?,31?/m0/s1 |
| InChIKey | PYSOVSCPBJKUBH-AGMGMLDOSA-N |
| XLogP | 8.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|