C32H47NO3S — CID 145177433
4-[4-[(6S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]sulfanylbenzoic acid (PubChem CID 145177433) has the molecular formula C32H47NO3S and a molecular weight of 525.80 g/mol. Its IUPAC name is 4-[4-[(6S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]sulfanylbenzoic acid.
| Compound Name | 4-[4-[(6S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 145177433 |
| Molecular Formula | C32H47NO3S |
| Molecular Weight | 525.80 g/mol |
| Exact Mass | 525.33 |
| IUPAC Name | 4-[4-[(6S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]sulfanylbenzoic acid |
| SMILES | CC[C@H]1CC2C3CCC(CCCC(=O)NSc4ccc(C(=O)O)cc4)C3(C)CCC2C2(C)CCCCC12 |
| InChI | InChI=1S/C32H47NO3S/c1-4-21-20-25-27-16-13-23(31(27,2)19-17-28(25)32(3)18-6-5-9-26(21)32)8-7-10-29(34)33-37-24-14-11-22(12-15-24)30(35)36/h11-12,14-15,21,23,25-28H,4-10,13,16-20H2,1-3H3,(H,33,34)(H,35,36)/t21-,23?,25?,26?,27?,28?,31?,32?/m0/s1 |
| InChIKey | JBDWNSBJCXQDIP-YJQPHQETSA-N |
| XLogP | 8.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.80 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|