C26H43F3N2O2S — CID 145090022
1-[3-[(3R,6S,9S,17R)-6-ethyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-(trifluoromethylsulfanyl)urea (PubChem CID 145090022) has the molecular formula C26H43F3N2O2S and a molecular weight of 504.70 g/mol. Its IUPAC name is 1-[3-[(3R,6S,9S,17R)-6-ethyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-(trifluoromethylsulfanyl)urea.
| Compound Name | 1-[3-[(3R,6S,9S,17R)-6-ethyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-(trifluoromethylsulfanyl)urea |
|---|---|
| PubChem CID | 145090022 |
| Molecular Formula | C26H43F3N2O2S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 1-[3-[(3R,6S,9S,17R)-6-ethyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-(trifluoromethylsulfanyl)urea |
| SMILES | CC[C@H]1CC2C3CC[C@H](CCCNC(=O)NSC(F)(F)F)C3(C)CC[C@@H]2C2(C)CC[C@@H](O)CC12 |
| InChI | InChI=1S/C26H43F3N2O2S/c1-4-16-14-19-20-8-7-17(6-5-13-30-23(33)31-34-26(27,28)29)24(20,2)12-10-21(19)25(3)11-9-18(32)15-22(16)25/h16-22,32H,4-15H2,1-3H3,(H2,30,31,33)/t16-,17-,18+,19?,20?,21-,22?,24?,25?/m0/s1 |
| InChIKey | FLKSBRXQYWOJNR-OITJNAAGSA-N |
| XLogP | 6.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|