C32H60O — CID 154685091
(3R,6S)-10,13-dimethyl-17-(4-methylpent-4-enyl)-6-propyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol;ethane (PubChem CID 154685091) has the molecular formula C32H60O and a molecular weight of 460.83 g/mol. Its IUPAC name is (3R,6S)-10,13-dimethyl-17-(4-methylpent-4-enyl)-6-propyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol;ethane.
| Compound Name | (3R,6S)-10,13-dimethyl-17-(4-methylpent-4-enyl)-6-propyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol;ethane |
|---|---|
| PubChem CID | 154685091 |
| Molecular Formula | C32H60O |
| Molecular Weight | 460.83 g/mol |
| Exact Mass | 460.46 |
| IUPAC Name | (3R,6S)-10,13-dimethyl-17-(4-methylpent-4-enyl)-6-propyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol;ethane |
| SMILES | C=C(C)CCCC1CCC2C3C[C@H](CCC)C4C[C@H](O)CCC4(C)C3CCC12C.CC.CC |
| InChI | InChI=1S/C28H48O.2C2H6/c1-6-8-20-17-23-24-12-11-21(10-7-9-19(2)3)27(24,4)16-14-25(23)28(5)15-13-22(29)18-26(20)28;2*1-2/h20-26,29H,2,6-18H2,1,3-5H3;2*1-2H3/t20-,21?,22+,23?,24?,25?,26?,27?,28?;;/m0../s1 |
| InChIKey | FHLWPNPKBSHRKV-SCIYMTMSSA-N |
| XLogP | 9.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.83 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|