C24H42N2O2 — CID 145092437
2-[(3R,5S,6S,8S,9S,10S,13R,14S)-6-ethyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylurea (PubChem CID 145092437) has the molecular formula C24H42N2O2 and a molecular weight of 390.61 g/mol. Its IUPAC name is 2-[(3R,5S,6S,8S,9S,10S,13R,14S)-6-ethyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylurea.
| Compound Name | 2-[(3R,5S,6S,8S,9S,10S,13R,14S)-6-ethyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylurea |
|---|---|
| PubChem CID | 145092437 |
| Molecular Formula | C24H42N2O2 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | 2-[(3R,5S,6S,8S,9S,10S,13R,14S)-6-ethyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylurea |
| SMILES | CC[C@H]1C[C@@H]2[C@H](CC[C@]3(C)C(CCNC(N)=O)CC[C@@H]23)[C@@]2(C)CC[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C24H42N2O2/c1-4-15-13-18-19-6-5-16(9-12-26-22(25)28)23(19,2)11-8-20(18)24(3)10-7-17(27)14-21(15)24/h15-21,27H,4-14H2,1-3H3,(H3,25,26,28)/t15-,16?,17+,18-,19-,20-,21-,23+,24+/m0/s1 |
| InChIKey | BADDBOUVZYIRBF-HBLXXWJHSA-N |
| XLogP | 4.70 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |