C37H63N3O2S — CID 142450724
ethane;2-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl N-[[6-[butyl(ethyl)amino]-3-pyridinyl]sulfanyl]carbamate (PubChem CID 142450724) has the molecular formula C37H63N3O2S and a molecular weight of 614.00 g/mol. Its IUPAC name is ethane;2-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl N-[[6-[butyl(ethyl)amino]-3-pyridinyl]sulfanyl]carbamate.
| Compound Name | ethane;2-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl N-[[6-[butyl(ethyl)amino]-3-pyridinyl]sulfanyl]carbamate |
|---|---|
| PubChem CID | 142450724 |
| Molecular Formula | C37H63N3O2S |
| Molecular Weight | 614.00 g/mol |
| Exact Mass | 613.46 |
| IUPAC Name | ethane;2-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl N-[[6-[butyl(ethyl)amino]-3-pyridinyl]sulfanyl]carbamate |
| SMILES | CC.CCCCN(CC)c1ccc(SNC(=O)OCCC2CCC3C4C[C@H](CC)C5CCCCC5(C)[C@H]4CCC23C)cn1 |
| InChI | InChI=1S/C35H57N3O2S.C2H6/c1-6-9-21-38(8-3)32-16-14-27(24-36-32)41-37-33(39)40-22-18-26-13-15-30-28-23-25(7-2)29-12-10-11-19-35(29,5)31(28)17-20-34(26,30)4;1-2/h14,16,24-26,28-31H,6-13,15,17-23H2,1-5H3,(H,37,39);1-2H3/t25-,26?,28?,29?,30?,31-,34?,35?;/m0./s1 |
| InChIKey | VPWKMIAOKSVGOG-SHQWNTFWSA-N |
| XLogP | 10.54 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.00 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|