C31H45NO3S — CID 145177574
methyl 4-[4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoylamino]sulfanylbenzoate (PubChem CID 145177574) has the molecular formula C31H45NO3S and a molecular weight of 511.77 g/mol. Its IUPAC name is methyl 4-[4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoylamino]sulfanylbenzoate.
| Compound Name | methyl 4-[4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoylamino]sulfanylbenzoate |
|---|---|
| PubChem CID | 145177574 |
| Molecular Formula | C31H45NO3S |
| Molecular Weight | 511.77 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | methyl 4-[4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoylamino]sulfanylbenzoate |
| SMILES | COC(=O)c1ccc(SNC(=O)CCCC2CCC3C4CCC5CCCCC5(C)C4CCC23C)cc1 |
| InChI | InChI=1S/C31H45NO3S/c1-30-19-5-4-7-22(30)12-16-25-26-17-13-23(31(26,2)20-18-27(25)30)8-6-9-28(33)32-36-24-14-10-21(11-15-24)29(34)35-3/h10-11,14-15,22-23,25-27H,4-9,12-13,16-20H2,1-3H3,(H,32,33) |
| InChIKey | SPSHYIHDGPHOFC-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.77 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|