C31H51F6NOS — CID 145177457
4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-(trifluoromethylsulfanyl)butanamide;ethane;(E)-1,1,1-trifluoro-2-methylbut-2-ene (PubChem CID 145177457) has the molecular formula C31H51F6NOS and a molecular weight of 599.81 g/mol. Its IUPAC name is 4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-(trifluoromethylsulfanyl)butanamide;ethane;(E)-1,1,1-trifluoro-2-methylbut-2-ene.
| Compound Name | 4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-(trifluoromethylsulfanyl)butanamide;ethane;(E)-1,1,1-trifluoro-2-methylbut-2-ene |
|---|---|
| PubChem CID | 145177457 |
| Molecular Formula | C31H51F6NOS |
| Molecular Weight | 599.81 g/mol |
| Exact Mass | 599.36 |
| IUPAC Name | 4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-(trifluoromethylsulfanyl)butanamide;ethane;(E)-1,1,1-trifluoro-2-methylbut-2-ene |
| SMILES | C/C=C(\C)C(F)(F)F.CC.CC12CCCCC1CCC1C2CCC2(C)C(CCCC(=O)NSC(F)(F)F)CCC12 |
| InChI | InChI=1S/C24H38F3NOS.C5H7F3.C2H6/c1-22-14-4-3-6-16(22)9-11-18-19-12-10-17(23(19,2)15-13-20(18)22)7-5-8-21(29)28-30-24(25,26)27;1-3-4(2)5(6,7)8;1-2/h16-20H,3-15H2,1-2H3,(H,28,29);3H,1-2H3;1-2H3/b;4-3+; |
| InChIKey | ZHVKVIWUFLEPDF-ITDJAWRYSA-N |
| XLogP | 11.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.81 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|