C32H50N4 — CID 145358577
N,N'-diamino-4-[(E)-4-[(6S,9S,17S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]but-1-enyl]benzenecarboximidamide (PubChem CID 145358577) has the molecular formula C32H50N4 and a molecular weight of 490.78 g/mol. Its IUPAC name is N,N'-diamino-4-[(E)-4-[(6S,9S,17S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]but-1-enyl]benzenecarboximidamide.
| Compound Name | N,N'-diamino-4-[(E)-4-[(6S,9S,17S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]but-1-enyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145358577 |
| Molecular Formula | C32H50N4 |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 490.40 |
| IUPAC Name | N,N'-diamino-4-[(E)-4-[(6S,9S,17S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]but-1-enyl]benzenecarboximidamide |
| SMILES | CC[C@H]1CC2C3CC[C@H](CC/C=C/c4ccc(/C(=N/N)NN)cc4)C3(C)CC[C@@H]2C2(C)CCCCC12 |
| InChI | InChI=1S/C32H50N4/c1-4-23-21-26-28-17-16-25(10-6-5-9-22-12-14-24(15-13-22)30(35-33)36-34)31(28,2)20-18-29(26)32(3)19-8-7-11-27(23)32/h5,9,12-15,23,25-29H,4,6-8,10-11,16-21,33-34H2,1-3H3,(H,35,36)/b9-5+/t23-,25-,26?,27?,28?,29-,31?,32?/m0/s1 |
| InChIKey | BRNNKBDFOPRRCP-GTQNZIEDSA-N |
| XLogP | 7.25 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|