C36H56N2O — CID 145089855
N-[(2S)-2-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-4-piperidin-1-ylbenzamide (PubChem CID 145089855) has the molecular formula C36H56N2O and a molecular weight of 532.86 g/mol. Its IUPAC name is N-[(2S)-2-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-4-piperidin-1-ylbenzamide.
| Compound Name | N-[(2S)-2-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 145089855 |
| Molecular Formula | C36H56N2O |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 532.44 |
| IUPAC Name | N-[(2S)-2-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-4-piperidin-1-ylbenzamide |
| SMILES | CC[C@H]1CC2C3CCC([C@H](C)CNC(=O)c4ccc(N5CCCCC5)cc4)C3(C)CC[C@@H]2C2(C)CCCCC12 |
| InChI | InChI=1S/C36H56N2O/c1-5-26-23-29-32-17-16-30(36(32,4)20-18-33(29)35(3)19-8-7-11-31(26)35)25(2)24-37-34(39)27-12-14-28(15-13-27)38-21-9-6-10-22-38/h12-15,25-26,29-33H,5-11,16-24H2,1-4H3,(H,37,39)/t25-,26+,29?,30?,31?,32?,33+,35?,36?/m1/s1 |
| InChIKey | IPPJDISJECRNRP-TYQMICQASA-N |
| XLogP | 8.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |