C36H59N3OS — CID 145089854
N-[(2S)-2-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-4-piperidin-1-ylbenzamide;thiohydroxylamine (PubChem CID 145089854) has the molecular formula C36H59N3OS and a molecular weight of 581.96 g/mol. Its IUPAC name is N-[(2S)-2-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-4-piperidin-1-ylbenzamide;thiohydroxylamine.
| Compound Name | N-[(2S)-2-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-4-piperidin-1-ylbenzamide;thiohydroxylamine |
|---|---|
| PubChem CID | 145089854 |
| Molecular Formula | C36H59N3OS |
| Molecular Weight | 581.96 g/mol |
| Exact Mass | 581.44 |
| IUPAC Name | N-[(2S)-2-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-4-piperidin-1-ylbenzamide;thiohydroxylamine |
| SMILES | CC[C@H]1CC2C3CCC([C@H](C)CNC(=O)c4ccc(N5CCCCC5)cc4)C3(C)CC[C@@H]2C2(C)CCCCC12.NS |
| InChI | InChI=1S/C36H56N2O.H3NS/c1-5-26-23-29-32-17-16-30(36(32,4)20-18-33(29)35(3)19-8-7-11-31(26)35)25(2)24-37-34(39)27-12-14-28(15-13-27)38-21-9-6-10-22-38;1-2/h12-15,25-26,29-33H,5-11,16-24H2,1-4H3,(H,37,39);2H,1H2/t25-,26+,29?,30?,31?,32?,33+,35?,36?;/m1./s1 |
| InChIKey | VEQSIJBYKTVIGA-JEQYTVFYSA-N |
| XLogP | 8.52 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.96 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|