C27H48O2 — CID 145177951
(6S,9S)-17-butyl-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;methyl formate (PubChem CID 145177951) has the molecular formula C27H48O2 and a molecular weight of 404.68 g/mol. Its IUPAC name is (6S,9S)-17-butyl-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;methyl formate.
| Compound Name | (6S,9S)-17-butyl-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;methyl formate |
|---|---|
| PubChem CID | 145177951 |
| Molecular Formula | C27H48O2 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.37 |
| IUPAC Name | (6S,9S)-17-butyl-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;methyl formate |
| SMILES | CCCCC1CCC2C3C[C@H](CC)C4CCCCC4(C)[C@H]3CCC12C.COC=O |
| InChI | InChI=1S/C25H44.C2H4O2/c1-5-7-10-19-12-13-22-20-17-18(6-2)21-11-8-9-15-25(21,4)23(20)14-16-24(19,22)3;1-4-2-3/h18-23H,5-17H2,1-4H3;2H,1H3/t18-,19?,20?,21?,22?,23-,24?,25?;/m0./s1 |
| InChIKey | CVLUUASMHHMQQZ-AHBBHPRDSA-N |
| XLogP | 7.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|