C32H59NO3 — CID 145078345
ethane;4-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(3-methyl-1,2,4-dioxazinan-4-yl)butan-1-one;methane (PubChem CID 145078345) has the molecular formula C32H59NO3 and a molecular weight of 505.83 g/mol. Its IUPAC name is ethane;4-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(3-methyl-1,2,4-dioxazinan-4-yl)butan-1-one;methane.
| Compound Name | ethane;4-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(3-methyl-1,2,4-dioxazinan-4-yl)butan-1-one;methane |
|---|---|
| PubChem CID | 145078345 |
| Molecular Formula | C32H59NO3 |
| Molecular Weight | 505.83 g/mol |
| Exact Mass | 505.45 |
| IUPAC Name | ethane;4-[(6S,9S)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(3-methyl-1,2,4-dioxazinan-4-yl)butan-1-one;methane |
| SMILES | C.CC.CC[C@H]1CC2C3CCC(CCCC(=O)N4CCOOC4C)C3(C)CC[C@@H]2C2(C)CCCCC12 |
| InChI | InChI=1S/C29H49NO3.C2H6.CH4/c1-5-21-19-23-25-13-12-22(9-8-11-27(31)30-17-18-32-33-20(30)2)28(25,3)16-14-26(23)29(4)15-7-6-10-24(21)29;1-2;/h20-26H,5-19H2,1-4H3;1-2H3;1H4/t20?,21-,22?,23?,24?,25?,26-,28?,29?;;/m0../s1 |
| InChIKey | KQLNVOPHWULYKF-XKOJRWSRSA-N |
| XLogP | 8.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.83 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|