C33H52N2O3S — CID 130382815
1-(4-tert-butylphenyl)sulfinyl-3-[3-[(17R)-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]urea (PubChem CID 130382815) has the molecular formula C33H52N2O3S and a molecular weight of 556.86 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfinyl-3-[3-[(17R)-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)sulfinyl-3-[3-[(17R)-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]urea |
|---|---|
| PubChem CID | 130382815 |
| Molecular Formula | C33H52N2O3S |
| Molecular Weight | 556.86 g/mol |
| Exact Mass | 556.37 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfinyl-3-[3-[(17R)-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]urea |
| SMILES | CC(C)(C)c1ccc(S(=O)NC(=O)NCCC[C@H]2CCC3C4C(O)CC5CCCCC5(C)C4CCC32C)cc1 |
| InChI | InChI=1S/C33H52N2O3S/c1-31(2,3)22-11-14-25(15-12-22)39(38)35-30(37)34-20-8-10-23-13-16-26-29-27(17-19-33(23,26)5)32(4)18-7-6-9-24(32)21-28(29)36/h11-12,14-15,23-24,26-29,36H,6-10,13,16-21H2,1-5H3,(H2,34,35,37)/t23-,24?,26?,27?,28?,29?,32?,33?,39?/m0/s1 |
| InChIKey | RKODWQSCBNLWPS-CFNHDLFVSA-N |
| XLogP | 7.11 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.86 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|