C27H45NO3 — CID 142366159
methane;methyl N-[3-[(6E,17R)-6-ethylidene-10,13-dimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]carbamate (PubChem CID 142366159) has the molecular formula C27H45NO3 and a molecular weight of 431.66 g/mol. Its IUPAC name is methane;methyl N-[3-[(6E,17R)-6-ethylidene-10,13-dimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]carbamate.
| Compound Name | methane;methyl N-[3-[(6E,17R)-6-ethylidene-10,13-dimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]carbamate |
|---|---|
| PubChem CID | 142366159 |
| Molecular Formula | C27H45NO3 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | methane;methyl N-[3-[(6E,17R)-6-ethylidene-10,13-dimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]carbamate |
| SMILES | C.C/C=C1/C(=O)C2C(CCC3(C)C2CC[C@@H]3CCCNC(=O)OC)C2(C)CCCCC12 |
| InChI | InChI=1S/C26H41NO3.CH4/c1-5-18-19-10-6-7-14-26(19,3)21-13-15-25(2)17(9-8-16-27-24(29)30-4)11-12-20(25)22(21)23(18)28;/h5,17,19-22H,6-16H2,1-4H3,(H,27,29);1H4/b18-5+;/t17-,19?,20?,21?,22?,25?,26?;/m0./s1 |
| InChIKey | JQTRJQGBGDLJML-WGZBPVGRSA-N |
| XLogP | 6.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|