C27H42O3 — CID 163909808
(4R)-4-[(6E,8R,9S,13R,17R)-6-ethylidene-10,13,15-trimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 163909808) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is (4R)-4-[(6E,8R,9S,13R,17R)-6-ethylidene-10,13,15-trimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(6E,8R,9S,13R,17R)-6-ethylidene-10,13,15-trimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 163909808 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | (4R)-4-[(6E,8R,9S,13R,17R)-6-ethylidene-10,13,15-trimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C/C=C1/C(=O)[C@H]2C3C(C)C[C@H]([C@H](C)CCC(=O)O)[C@@]3(C)CC[C@@H]2C2(C)CCCCC12 |
| InChI | InChI=1S/C27H42O3/c1-6-18-19-9-7-8-13-26(19,4)20-12-14-27(5)21(16(2)10-11-22(28)29)15-17(3)24(27)23(20)25(18)30/h6,16-17,19-21,23-24H,7-15H2,1-5H3,(H,28,29)/b18-6+/t16-,17?,19?,20+,21-,23-,24?,26?,27-/m1/s1 |
| InChIKey | QRCKHWRWBGGTNL-ZSFLGCKSSA-N |
| XLogP | 6.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|