C27H43NO3 — CID 134557782
methyl N-[(3R)-3-[(5R,6E,8S,9S,10R,13R)-6-ethylidene-10,13-dimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]carbamate (PubChem CID 134557782) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is methyl N-[(3R)-3-[(5R,6E,8S,9S,10R,13R)-6-ethylidene-10,13-dimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]carbamate.
| Compound Name | methyl N-[(3R)-3-[(5R,6E,8S,9S,10R,13R)-6-ethylidene-10,13-dimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]carbamate |
|---|---|
| PubChem CID | 134557782 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | methyl N-[(3R)-3-[(5R,6E,8S,9S,10R,13R)-6-ethylidene-10,13-dimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]carbamate |
| SMILES | C/C=C1/C(=O)[C@H]2C3CCC([C@H](C)CCNC(=O)OC)[C@@]3(C)CC[C@@H]2[C@@]2(C)CCCC[C@@H]12 |
| InChI | InChI=1S/C27H43NO3/c1-6-18-20-9-7-8-14-26(20,3)22-12-15-27(4)19(10-11-21(27)23(22)24(18)29)17(2)13-16-28-25(30)31-5/h6,17,19-23H,7-16H2,1-5H3,(H,28,30)/b18-6+/t17-,19?,20+,21?,22+,23+,26+,27-/m1/s1 |
| InChIKey | AHPDEXOYJDPPPK-VYMVRMPISA-N |
| XLogP | 6.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|