C30H52O3 — CID 145410535
ethane;methyl 4-[(6E)-6-ethylidene-10,13-dimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 145410535) has the molecular formula C30H52O3 and a molecular weight of 460.74 g/mol. Its IUPAC name is ethane;methyl 4-[(6E)-6-ethylidene-10,13-dimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | ethane;methyl 4-[(6E)-6-ethylidene-10,13-dimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 145410535 |
| Molecular Formula | C30H52O3 |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | ethane;methyl 4-[(6E)-6-ethylidene-10,13-dimethyl-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | C/C=C1/C(=O)C2C3CCC(CCCC(=O)OC)C3(C)CCC2C2(C)CCCCC12.CC.CC |
| InChI | InChI=1S/C26H40O3.2C2H6/c1-5-18-19-10-6-7-15-26(19,3)21-14-16-25(2)17(9-8-11-22(27)29-4)12-13-20(25)23(21)24(18)28;2*1-2/h5,17,19-21,23H,6-16H2,1-4H3;2*1-2H3/b18-5+;; |
| InChIKey | VOHGVAQAGKBCLM-MONHGIHASA-N |
| XLogP | 8.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|