C24H33FO4 — CID 154957796
methyl 4-(2-fluoro-10,13-dimethyl-3,7-dioxo-5,6,8,9,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-17-yl)butanoate (PubChem CID 154957796) has the molecular formula C24H33FO4 and a molecular weight of 404.52 g/mol. Its IUPAC name is methyl 4-(2-fluoro-10,13-dimethyl-3,7-dioxo-5,6,8,9,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-17-yl)butanoate.
| Compound Name | methyl 4-(2-fluoro-10,13-dimethyl-3,7-dioxo-5,6,8,9,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-17-yl)butanoate |
|---|---|
| PubChem CID | 154957796 |
| Molecular Formula | C24H33FO4 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | methyl 4-(2-fluoro-10,13-dimethyl-3,7-dioxo-5,6,8,9,11,12,14,15,16,17-decahydro-4H-cyclopenta[a]phenanthren-17-yl)butanoate |
| SMILES | COC(=O)CCCC1CCC2C3C(=O)CC4CC(=O)C(F)=CC4(C)C3CCC12C |
| InChI | InChI=1S/C24H33FO4/c1-23-10-9-17-22(16(23)8-7-14(23)5-4-6-21(28)29-3)20(27)12-15-11-19(26)18(25)13-24(15,17)2/h13-17,22H,4-12H2,1-3H3 |
| InChIKey | FHGXGSIXGMBOEV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|