C26H42I2O4 — CID 145410726
ethane;methyl 4-[(3R,5S,10S)-3,7-diiodooxy-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 145410726) has the molecular formula C26H42I2O4 and a molecular weight of 672.43 g/mol. Its IUPAC name is ethane;methyl 4-[(3R,5S,10S)-3,7-diiodooxy-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | ethane;methyl 4-[(3R,5S,10S)-3,7-diiodooxy-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 145410726 |
| Molecular Formula | C26H42I2O4 |
| Molecular Weight | 672.43 g/mol |
| Exact Mass | 672.12 |
| IUPAC Name | ethane;methyl 4-[(3R,5S,10S)-3,7-diiodooxy-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | CC.COC(=O)CCCC1CCC2C3C(OI)=C[C@@H]4C[C@H](OI)CC[C@]4(C)C3CCC12C |
| InChI | InChI=1S/C24H36I2O4.C2H6/c1-23-12-10-19-22(18(23)8-7-15(23)5-4-6-21(27)28-3)20(30-26)14-16-13-17(29-25)9-11-24(16,19)2;1-2/h14-19,22H,4-13H2,1-3H3;1-2H3/t15?,16-,17+,18?,19?,22?,23?,24-;/m0./s1 |
| InChIKey | UHHYEWUXMMFIQM-UTKDIICTSA-N |
| XLogP | 8.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.43 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|