C29H50O3Si — CID 158308330
methyl (4R)-4-[(3R,10S,13R,17R)-3,10,13-trimethyl-7-trimethylsilyloxy-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 158308330) has the molecular formula C29H50O3Si and a molecular weight of 474.80 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,10S,13R,17R)-3,10,13-trimethyl-7-trimethylsilyloxy-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,10S,13R,17R)-3,10,13-trimethyl-7-trimethylsilyloxy-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 158308330 |
| Molecular Formula | C29H50O3Si |
| Molecular Weight | 474.80 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | methyl (4R)-4-[(3R,10S,13R,17R)-3,10,13-trimethyl-7-trimethylsilyloxy-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CCC2C3C(O[Si](C)(C)C)=CC4C[C@H](C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H50O3Si/c1-19-13-15-28(3)21(17-19)18-25(32-33(6,7)8)27-23-11-10-22(20(2)9-12-26(30)31-5)29(23,4)16-14-24(27)28/h18-24,27H,9-17H2,1-8H3/t19-,20-,21?,22-,23?,24?,27?,28+,29-/m1/s1 |
| InChIKey | DBHWZOSKWBTUJF-VJEZEVFKSA-N |
| XLogP | 7.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.80 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|