C27H44O2 — CID 58483082
methyl (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3,10,12,13-tetramethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 58483082) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3,10,12,13-tetramethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3,10,12,13-tetramethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 58483082 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | methyl (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3,10,12,13-tetramethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C=C[C@@H]4C[C@H](C)CC[C@]4(C)[C@H]3C[C@H](C)[C@]12C |
| InChI | InChI=1S/C27H44O2/c1-17-13-14-26(4)20(15-17)8-9-21-23-11-10-22(18(2)7-12-25(28)29-6)27(23,5)19(3)16-24(21)26/h8-9,17-24H,7,10-16H2,1-6H3/t17-,18-,19+,20-,21+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | HNAFRSYXCMOVSZ-UFBKPDGGSA-N |
| XLogP | 6.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|