C27H47NO3 — CID 163720854
methyl 4-[7-(hydroxymethylamino)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 163720854) has the molecular formula C27H47NO3 and a molecular weight of 433.68 g/mol. Its IUPAC name is methyl 4-[7-(hydroxymethylamino)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl 4-[7-(hydroxymethylamino)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 163720854 |
| Molecular Formula | C27H47NO3 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.36 |
| IUPAC Name | methyl 4-[7-(hydroxymethylamino)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CCC(C)C1CCC2C3C(NCO)CC4CC(C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C27H47NO3/c1-17-10-12-26(3)19(14-17)15-23(28-16-29)25-21-8-7-20(18(2)6-9-24(30)31-5)27(21,4)13-11-22(25)26/h17-23,25,28-29H,6-16H2,1-5H3 |
| InChIKey | KRKYVLQJDFSUQP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|