C32H57N3O3 — CID 138655519
methyl (4R)-4-[(5R,7R,10S,13R,17R)-7-acetamido-10,13-dimethyl-3-[2-(propan-2-ylamino)ethylamino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 138655519) has the molecular formula C32H57N3O3 and a molecular weight of 531.83 g/mol. Its IUPAC name is methyl (4R)-4-[(5R,7R,10S,13R,17R)-7-acetamido-10,13-dimethyl-3-[2-(propan-2-ylamino)ethylamino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(5R,7R,10S,13R,17R)-7-acetamido-10,13-dimethyl-3-[2-(propan-2-ylamino)ethylamino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 138655519 |
| Molecular Formula | C32H57N3O3 |
| Molecular Weight | 531.83 g/mol |
| Exact Mass | 531.44 |
| IUPAC Name | methyl (4R)-4-[(5R,7R,10S,13R,17R)-7-acetamido-10,13-dimethyl-3-[2-(propan-2-ylamino)ethylamino]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CCC2C3C(NC(C)=O)C[C@H]4CC(NCCNC(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C32H57N3O3/c1-20(2)33-16-17-34-24-12-14-31(5)23(18-24)19-28(35-22(4)36)30-26-10-9-25(21(3)8-11-29(37)38-7)32(26,6)15-13-27(30)31/h20-21,23-28,30,33-34H,8-19H2,1-7H3,(H,35,36)/t21-,23-,24?,25-,26?,27?,28?,30?,31+,32-/m1/s1 |
| InChIKey | LRBSNFHBBBHEKV-LZEDUFNVSA-N |
| XLogP | 5.31 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.83 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|