C36H67N3O3 — CID 161205644
methyl (4R)-4-[(3S,5S,7S,10S,13R,17R)-3-[3-(8-aminooctylamino)propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 161205644) has the molecular formula C36H67N3O3 and a molecular weight of 589.95 g/mol. Its IUPAC name is methyl (4R)-4-[(3S,5S,7S,10S,13R,17R)-3-[3-(8-aminooctylamino)propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3S,5S,7S,10S,13R,17R)-3-[3-(8-aminooctylamino)propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 161205644 |
| Molecular Formula | C36H67N3O3 |
| Molecular Weight | 589.95 g/mol |
| Exact Mass | 589.52 |
| IUPAC Name | methyl (4R)-4-[(3S,5S,7S,10S,13R,17R)-3-[3-(8-aminooctylamino)propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CCC2C3C(O)C[C@@H]4C[C@@H](NCCCNCCCCCCCCN)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C36H67N3O3/c1-26(12-15-33(41)42-4)29-13-14-30-34-31(17-19-36(29,30)3)35(2)18-16-28(24-27(35)25-32(34)40)39-23-11-22-38-21-10-8-6-5-7-9-20-37/h26-32,34,38-40H,5-25,37H2,1-4H3/t26-,27+,28+,29-,30?,31?,32?,34?,35+,36-/m1/s1 |
| InChIKey | UVODSTWRSOJGGB-XBXMEBMLSA-N |
| XLogP | 6.44 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.95 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|