C35H67N3O — CID 157390578
(3S,5S,10S,13R,17R)-3-[4-(4-aminobutylamino)butylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol (PubChem CID 157390578) has the molecular formula C35H67N3O and a molecular weight of 545.94 g/mol. Its IUPAC name is (3S,5S,10S,13R,17R)-3-[4-(4-aminobutylamino)butylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol.
| Compound Name | (3S,5S,10S,13R,17R)-3-[4-(4-aminobutylamino)butylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol |
|---|---|
| PubChem CID | 157390578 |
| Molecular Formula | C35H67N3O |
| Molecular Weight | 545.94 g/mol |
| Exact Mass | 545.53 |
| IUPAC Name | (3S,5S,10S,13R,17R)-3-[4-(4-aminobutylamino)butylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3C(O)C[C@@H]4C[C@@H](NCCCCNCCCCN)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C35H67N3O/c1-25(2)11-10-12-26(3)29-13-14-30-33-31(16-18-35(29,30)5)34(4)17-15-28(23-27(34)24-32(33)39)38-22-9-8-21-37-20-7-6-19-36/h25-33,37-39H,6-24,36H2,1-5H3/t26-,27+,28+,29-,30?,31?,32?,33?,34+,35-/m1/s1 |
| InChIKey | CJZJWHXUMUTACA-PDKBEVDZSA-N |
| XLogP | 7.15 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.94 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|