C38H71N3O3 — CID 167617723
(6R)-6-[(3S,5R,10S,13R,17R)-3-[3-(8-aminooctylamino)propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid (PubChem CID 167617723) has the molecular formula C38H71N3O3 and a molecular weight of 618.00 g/mol. Its IUPAC name is (6R)-6-[(3S,5R,10S,13R,17R)-3-[3-(8-aminooctylamino)propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid.
| Compound Name | (6R)-6-[(3S,5R,10S,13R,17R)-3-[3-(8-aminooctylamino)propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 167617723 |
| Molecular Formula | C38H71N3O3 |
| Molecular Weight | 618.00 g/mol |
| Exact Mass | 617.55 |
| IUPAC Name | (6R)-6-[(3S,5R,10S,13R,17R)-3-[3-(8-aminooctylamino)propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid |
| SMILES | CC(CCC[C@@H](C)[C@H]1CCC2C3C(O)C[C@H]4C[C@@H](NCCCNCCCCCCCCN)CC[C@]4(C)C3CC[C@@]21C)C(=O)O |
| InChI | InChI=1S/C38H71N3O3/c1-27(13-11-14-28(2)36(43)44)31-15-16-32-35-33(18-20-38(31,32)4)37(3)19-17-30(25-29(37)26-34(35)42)41-24-12-23-40-22-10-8-6-5-7-9-21-39/h27-35,40-42H,5-26,39H2,1-4H3,(H,43,44)/t27-,28?,29-,30+,31-,32?,33?,34?,35?,37+,38-/m1/s1 |
| InChIKey | KQVUVTVYKFKOSO-WZTBATPQSA-N |
| XLogP | 7.38 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.00 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|