C37H72N4O — CID 90057768
(3R)-3-[3-[4-(3-aminopropylamino)butylamino]propylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-ol (PubChem CID 90057768) has the molecular formula C37H72N4O and a molecular weight of 589.01 g/mol. Its IUPAC name is (3R)-3-[3-[4-(3-aminopropylamino)butylamino]propylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-ol.
| Compound Name | (3R)-3-[3-[4-(3-aminopropylamino)butylamino]propylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-ol |
|---|---|
| PubChem CID | 90057768 |
| Molecular Formula | C37H72N4O |
| Molecular Weight | 589.01 g/mol |
| Exact Mass | 588.57 |
| IUPAC Name | (3R)-3-[3-[4-(3-aminopropylamino)butylamino]propylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-ol |
| SMILES | CC(C)CCC[C@@H](C)C1CCC2C3CC(O)C4C[C@H](NCCCNCCCCNCCCN)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C37H72N4O/c1-27(2)11-8-12-28(3)31-13-14-32-30-26-35(42)34-25-29(15-17-37(34,5)33(30)16-18-36(31,32)4)41-24-10-23-40-21-7-6-20-39-22-9-19-38/h27-35,39-42H,6-26,38H2,1-5H3/t28-,29-,30?,31?,32?,33?,34?,35?,36?,37?/m1/s1 |
| InChIKey | QIWPLXJLXJYKOO-GEOGJTOHSA-N |
| XLogP | 6.74 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.01 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|