C35H64N2O5 — CID 25216719
methyl (4S)-4-[(3S,6R,10R,13R)-3-[3-[4-(3-aminopropoxy)butoxy]propylamino]-6-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 25216719) has the molecular formula C35H64N2O5 and a molecular weight of 592.91 g/mol. Its IUPAC name is methyl (4S)-4-[(3S,6R,10R,13R)-3-[3-[4-(3-aminopropoxy)butoxy]propylamino]-6-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4S)-4-[(3S,6R,10R,13R)-3-[3-[4-(3-aminopropoxy)butoxy]propylamino]-6-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 25216719 |
| Molecular Formula | C35H64N2O5 |
| Molecular Weight | 592.91 g/mol |
| Exact Mass | 592.48 |
| IUPAC Name | methyl (4S)-4-[(3S,6R,10R,13R)-3-[3-[4-(3-aminopropoxy)butoxy]propylamino]-6-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@H](C)C1CCC2C3C[C@@H](O)C4C[C@@H](NCCCOCCCCOCCCN)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C35H64N2O5/c1-25(9-12-33(39)40-4)28-10-11-29-27-24-32(38)31-23-26(13-15-35(31,3)30(27)14-16-34(28,29)2)37-18-8-22-42-20-6-5-19-41-21-7-17-36/h25-32,37-38H,5-24,36H2,1-4H3/t25-,26-,27?,28?,29?,30?,31?,32+,34+,35+/m0/s1 |
| InChIKey | LUNNGFSHZZQSAV-VCYWCVRJSA-N |
| XLogP | 5.72 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.91 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|