C30H56N2O — CID 138742658
(3S,5S,6R,10R,13R)-3-(3-aminopropylamino)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-ol (PubChem CID 138742658) has the molecular formula C30H56N2O and a molecular weight of 460.79 g/mol. Its IUPAC name is (3S,5S,6R,10R,13R)-3-(3-aminopropylamino)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-ol.
| Compound Name | (3S,5S,6R,10R,13R)-3-(3-aminopropylamino)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-ol |
|---|---|
| PubChem CID | 138742658 |
| Molecular Formula | C30H56N2O |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 460.44 |
| IUPAC Name | (3S,5S,6R,10R,13R)-3-(3-aminopropylamino)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-ol |
| SMILES | CC(C)CCC[C@@H](C)C1CCC2C3C[C@@H](O)[C@H]4C[C@@H](NCCCN)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H56N2O/c1-20(2)8-6-9-21(3)24-10-11-25-23-19-28(33)27-18-22(32-17-7-16-31)12-14-30(27,5)26(23)13-15-29(24,25)4/h20-28,32-33H,6-19,31H2,1-5H3/t21-,22+,23?,24?,25?,26?,27-,28-,29-,30-/m1/s1 |
| InChIKey | XWOBMTRBBOSBHR-NGQMKZBRSA-N |
| XLogP | 6.39 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|