C38H73N3O — CID 157155494
(3S,6R,10R,13R,17R)-6-[8-(3-aminopropylamino)octylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 157155494) has the molecular formula C38H73N3O and a molecular weight of 588.02 g/mol. Its IUPAC name is (3S,6R,10R,13R,17R)-6-[8-(3-aminopropylamino)octylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,6R,10R,13R,17R)-6-[8-(3-aminopropylamino)octylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 157155494 |
| Molecular Formula | C38H73N3O |
| Molecular Weight | 588.02 g/mol |
| Exact Mass | 587.58 |
| IUPAC Name | (3S,6R,10R,13R,17R)-6-[8-(3-aminopropylamino)octylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3C[C@@H](NCCCCCCCCNCCCN)C4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C38H73N3O/c1-28(2)14-12-15-29(3)32-16-17-33-31-27-36(41-25-11-9-7-6-8-10-23-40-24-13-22-39)35-26-30(42)18-20-38(35,5)34(31)19-21-37(32,33)4/h28-36,40-42H,6-27,39H2,1-5H3/t29-,30+,31?,32-,33?,34?,35?,36-,37-,38-/m1/s1 |
| InChIKey | ALTHEZNHPBETHX-CQWLLKEHSA-N |
| XLogP | 8.32 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.02 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|