C30H56N2O2 — CID 168930755
(3S,5R,9S,14S)-6-(3-aminopropylamino)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5-diol (PubChem CID 168930755) has the molecular formula C30H56N2O2 and a molecular weight of 476.79 g/mol. Its IUPAC name is (3S,5R,9S,14S)-6-(3-aminopropylamino)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5-diol.
| Compound Name | (3S,5R,9S,14S)-6-(3-aminopropylamino)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5-diol |
|---|---|
| PubChem CID | 168930755 |
| Molecular Formula | C30H56N2O2 |
| Molecular Weight | 476.79 g/mol |
| Exact Mass | 476.43 |
| IUPAC Name | (3S,5R,9S,14S)-6-(3-aminopropylamino)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5-diol |
| SMILES | CC(C)CCC[C@@H](C)C1CC[C@H]2C3CC(NCCCN)[C@@]4(O)C[C@@H](O)CCC4(C)[C@H]3CCC12C |
| InChI | InChI=1S/C30H56N2O2/c1-20(2)8-6-9-21(3)24-10-11-25-23-18-27(32-17-7-16-31)30(34)19-22(33)12-15-29(30,5)26(23)13-14-28(24,25)4/h20-27,32-34H,6-19,31H2,1-5H3/t21-,22+,23?,24?,25+,26+,27?,28?,29?,30+/m1/s1 |
| InChIKey | LTPHOKGKGRTELV-XFYQABJXSA-N |
| XLogP | 5.50 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.79 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|