C29H53N3O3 — CID 123522655
methyl 4-[3-[2-[2-(dimethylamino)ethyl]hydrazinyl]-6-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 123522655) has the molecular formula C29H53N3O3 and a molecular weight of 491.76 g/mol. Its IUPAC name is methyl 4-[3-[2-[2-(dimethylamino)ethyl]hydrazinyl]-6-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl 4-[3-[2-[2-(dimethylamino)ethyl]hydrazinyl]-6-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 123522655 |
| Molecular Formula | C29H53N3O3 |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 491.41 |
| IUPAC Name | methyl 4-[3-[2-[2-(dimethylamino)ethyl]hydrazinyl]-6-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CCC(C)C1CCC2C3CC(O)C4CC(NNCCN(C)C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C29H53N3O3/c1-19(7-10-27(34)35-6)22-8-9-23-21-18-26(33)25-17-20(31-30-15-16-32(4)5)11-13-29(25,3)24(21)12-14-28(22,23)2/h19-26,30-31,33H,7-18H2,1-6H3 |
| InChIKey | OXLMICBSAFULNS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|