C29H55N3O — CID 56666505
(2S)-2-[(3R,5R,8R,9S,10S,13S,14S,17R)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propan-1-ol (PubChem CID 56666505) has the molecular formula C29H55N3O and a molecular weight of 461.78 g/mol. Its IUPAC name is (2S)-2-[(3R,5R,8R,9S,10S,13S,14S,17R)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propan-1-ol.
| Compound Name | (2S)-2-[(3R,5R,8R,9S,10S,13S,14S,17R)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propan-1-ol |
|---|---|
| PubChem CID | 56666505 |
| Molecular Formula | C29H55N3O |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 461.43 |
| IUPAC Name | (2S)-2-[(3R,5R,8R,9S,10S,13S,14S,17R)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propan-1-ol |
| SMILES | C[C@H](CO)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](NCCCNCCCCN)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H55N3O/c1-21(20-33)25-9-10-26-24-8-7-22-19-23(32-18-6-17-31-16-5-4-15-30)11-13-28(22,2)27(24)12-14-29(25,26)3/h21-27,31-33H,4-20,30H2,1-3H3/t21-,22-,23-,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | FIDDIKJIFFBZQA-OWDZWQNUSA-N |
| XLogP | 4.95 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|