C34H64N4O — CID 163675704
(4R)-4-[(3S,10S,13R,17R)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-propan-2-ylpentanamide (PubChem CID 163675704) has the molecular formula C34H64N4O and a molecular weight of 544.91 g/mol. Its IUPAC name is (4R)-4-[(3S,10S,13R,17R)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-propan-2-ylpentanamide.
| Compound Name | (4R)-4-[(3S,10S,13R,17R)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 163675704 |
| Molecular Formula | C34H64N4O |
| Molecular Weight | 544.91 g/mol |
| Exact Mass | 544.51 |
| IUPAC Name | (4R)-4-[(3S,10S,13R,17R)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-propan-2-ylpentanamide |
| SMILES | CC(C)NC(=O)CC[C@@H](C)[C@H]1CCC2C3CCC4C[C@@H](NCCCNCCCCN)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C34H64N4O/c1-24(2)38-32(39)14-9-25(3)29-12-13-30-28-11-10-26-23-27(37-22-8-21-36-20-7-6-19-35)15-17-33(26,4)31(28)16-18-34(29,30)5/h24-31,36-37H,6-23,35H2,1-5H3,(H,38,39)/t25-,26?,27+,28?,29-,30?,31?,33+,34-/m1/s1 |
| InChIKey | JGMXYVRPUGYPGW-UVWNKTBJSA-N |
| XLogP | 6.26 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.91 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|