C33H63N3O4S — CID 144703020
[(3R)-6-[(3S,8S,10S,13R)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhexan-3-yl] hydrogen sulfate (PubChem CID 144703020) has the molecular formula C33H63N3O4S and a molecular weight of 597.95 g/mol. Its IUPAC name is [(3R)-6-[(3S,8S,10S,13R)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhexan-3-yl] hydrogen sulfate.
| Compound Name | [(3R)-6-[(3S,8S,10S,13R)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhexan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 144703020 |
| Molecular Formula | C33H63N3O4S |
| Molecular Weight | 597.95 g/mol |
| Exact Mass | 597.45 |
| IUPAC Name | [(3R)-6-[(3S,8S,10S,13R)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhexan-3-yl] hydrogen sulfate |
| SMILES | CC(C)[C@@H](CCCC1CCC2[C@@H]3CCC4C[C@@H](NCCCNCCCCN)CC[C@]4(C)C3CC[C@]12C)OS(=O)(=O)O |
| InChI | InChI=1S/C33H63N3O4S/c1-24(2)31(40-41(37,38)39)10-7-9-25-12-14-29-28-13-11-26-23-27(36-22-8-21-35-20-6-5-19-34)15-17-33(26,4)30(28)16-18-32(25,29)3/h24-31,35-36H,5-23,34H2,1-4H3,(H,37,38,39)/t25?,26?,27-,28-,29?,30?,31+,32+,33-/m0/s1 |
| InChIKey | XXKMLOZYNOKZEG-HPZVZWRPSA-N |
| XLogP | 6.34 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.95 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|