C33H63N3O6S — CID 154687508
[6-[(5S)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4,5-dihydroxy-2-methylhexan-3-yl] hydrogen sulfate (PubChem CID 154687508) has the molecular formula C33H63N3O6S and a molecular weight of 629.95 g/mol. Its IUPAC name is [6-[(5S)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4,5-dihydroxy-2-methylhexan-3-yl] hydrogen sulfate.
| Compound Name | [6-[(5S)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4,5-dihydroxy-2-methylhexan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 154687508 |
| Molecular Formula | C33H63N3O6S |
| Molecular Weight | 629.95 g/mol |
| Exact Mass | 629.44 |
| IUPAC Name | [6-[(5S)-3-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4,5-dihydroxy-2-methylhexan-3-yl] hydrogen sulfate |
| SMILES | CC(C)C(OS(=O)(=O)O)C(O)C(O)CC1CCC2C3CC[C@H]4CC(NCCCNCCCCN)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C33H63N3O6S/c1-22(2)31(42-43(39,40)41)30(38)29(37)21-24-9-11-27-26-10-8-23-20-25(36-19-7-18-35-17-6-5-16-34)12-14-32(23,3)28(26)13-15-33(24,27)4/h22-31,35-38H,5-21,34H2,1-4H3,(H,39,40,41)/t23-,24?,25?,26?,27?,28?,29?,30?,31?,32?,33?/m0/s1 |
| InChIKey | FINVXNPMIZFHLV-BKFZIJBMSA-N |
| XLogP | 4.28 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.95 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|