C36H72N4O5S — CID 143567864
[6-[3-[3-[4-(3-aminopropylamino)butylamino]propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhexan-3-yl] hydrogen sulfate;hydrate (PubChem CID 143567864) has the molecular formula C36H72N4O5S and a molecular weight of 673.06 g/mol. Its IUPAC name is [6-[3-[3-[4-(3-aminopropylamino)butylamino]propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhexan-3-yl] hydrogen sulfate;hydrate.
| Compound Name | [6-[3-[3-[4-(3-aminopropylamino)butylamino]propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhexan-3-yl] hydrogen sulfate;hydrate |
|---|---|
| PubChem CID | 143567864 |
| Molecular Formula | C36H72N4O5S |
| Molecular Weight | 673.06 g/mol |
| Exact Mass | 672.52 |
| IUPAC Name | [6-[3-[3-[4-(3-aminopropylamino)butylamino]propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhexan-3-yl] hydrogen sulfate;hydrate |
| SMILES | CC(C)C(CCCC1CCC2C3CCC4CC(NCCCNCCCCNCCCN)CCC4(C)C3CCC12C)OS(=O)(=O)O.O |
| InChI | InChI=1S/C36H70N4O4S.H2O/c1-27(2)34(44-45(41,42)43)11-7-10-28-13-15-32-31-14-12-29-26-30(16-18-36(29,4)33(31)17-19-35(28,32)3)40-25-9-24-39-22-6-5-21-38-23-8-20-37;/h27-34,38-40H,5-26,37H2,1-4H3,(H,41,42,43);1H2 |
| InChIKey | BLQGJSULPRLXLS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 157.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.06 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|