C37H73N3O7S — CID 154687491
[6-[(8S)-5-[3-(4-aminobutylamino)propylamino]-4,4-dihydroxy-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-15-yl]-2-methylhexan-3-yl] hydrogen sulfate;ethane (PubChem CID 154687491) has the molecular formula C37H73N3O7S and a molecular weight of 704.07 g/mol. Its IUPAC name is [6-[(8S)-5-[3-(4-aminobutylamino)propylamino]-4,4-dihydroxy-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-15-yl]-2-methylhexan-3-yl] hydrogen sulfate;ethane.
| Compound Name | [6-[(8S)-5-[3-(4-aminobutylamino)propylamino]-4,4-dihydroxy-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-15-yl]-2-methylhexan-3-yl] hydrogen sulfate;ethane |
|---|---|
| PubChem CID | 154687491 |
| Molecular Formula | C37H73N3O7S |
| Molecular Weight | 704.07 g/mol |
| Exact Mass | 703.52 |
| IUPAC Name | [6-[(8S)-5-[3-(4-aminobutylamino)propylamino]-4,4-dihydroxy-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecan-15-yl]-2-methylhexan-3-yl] hydrogen sulfate;ethane |
| SMILES | CC.CC.CC(C)C(CCCC1CCC2C3CC[C@@]45OC4C(NCCCNCCCCN)C(O)(O)CC5(C)C3CCC12C)OS(=O)(=O)O |
| InChI | InChI=1S/C33H61N3O7S.2C2H6/c1-22(2)27(43-44(39,40)41)10-7-9-23-11-12-25-24-13-16-32-29(42-32)28(36-20-8-19-35-18-6-5-17-34)33(37,38)21-31(32,4)26(24)14-15-30(23,25)3;2*1-2/h22-29,35-38H,5-21,34H2,1-4H3,(H,39,40,41);2*1-2H3/t23?,24?,25?,26?,27?,28?,29?,30?,31?,32-;;/m1../s1 |
| InChIKey | NLJPNTJGJSWOJM-OWMZYODCSA-N |
| XLogP | 5.81 |
| TPSA | 166.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.07 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|