C33H59N3O3 — CID 169258860
methyl 2-[4-[3-(4-aminobutylamino)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]-3-methylbutanoate (PubChem CID 169258860) has the molecular formula C33H59N3O3 and a molecular weight of 545.85 g/mol. Its IUPAC name is methyl 2-[4-[3-(4-aminobutylamino)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]-3-methylbutanoate.
| Compound Name | methyl 2-[4-[3-(4-aminobutylamino)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 169258860 |
| Molecular Formula | C33H59N3O3 |
| Molecular Weight | 545.85 g/mol |
| Exact Mass | 545.46 |
| IUPAC Name | methyl 2-[4-[3-(4-aminobutylamino)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoylamino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)CCCC1CCC2C3CCC4CC(NCCCCN)CCC4(C)C3CCC12C)C(C)C |
| InChI | InChI=1S/C33H59N3O3/c1-22(2)30(31(38)39-5)36-29(37)10-8-9-23-12-14-27-26-13-11-24-21-25(35-20-7-6-19-34)15-17-33(24,4)28(26)16-18-32(23,27)3/h22-28,30,35H,6-21,34H2,1-5H3,(H,36,37) |
| InChIKey | SPCYEKRDLWPVBA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.85 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|