C36H69N5O — CID 142305144
4-[3-[3-[bis(3-aminopropyl)amino]propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-diethylbutanamide (PubChem CID 142305144) has the molecular formula C36H69N5O and a molecular weight of 587.98 g/mol. Its IUPAC name is 4-[3-[3-[bis(3-aminopropyl)amino]propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-diethylbutanamide.
| Compound Name | 4-[3-[3-[bis(3-aminopropyl)amino]propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-diethylbutanamide |
|---|---|
| PubChem CID | 142305144 |
| Molecular Formula | C36H69N5O |
| Molecular Weight | 587.98 g/mol |
| Exact Mass | 587.55 |
| IUPAC Name | 4-[3-[3-[bis(3-aminopropyl)amino]propylamino]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)CCCC1CCC2C3CCC4CC(NCCCN(CCCN)CCCN)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C36H69N5O/c1-5-41(6-2)34(42)12-7-11-28-14-16-32-31-15-13-29-27-30(17-19-36(29,4)33(31)18-20-35(28,32)3)39-23-10-26-40(24-8-21-37)25-9-22-38/h28-33,39H,5-27,37-38H2,1-4H3 |
| InChIKey | DZACTEKZKYXMMK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.98 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|